38496-18-3
| Name | 2,6-Dichloronicotinic acid |
| CAS | 38496-18-3 |
| EINECS(EC#) | 609-561-1 |
| Molecular Formula | C6H3Cl2NO2 |
| MDL Number | MFCD00075583 |
| Molecular Weight | 192 |
| MOL File | 38496-18-3.mol |
Chemical Properties
| Appearance | Off-white toyellow soli |
| Melting point | 140-143 °C(lit.) |
| Boiling point | 351.2±37.0 °C(Predicted) |
| density | 1.612±0.06 g/cm3(Predicted) |
| Fp | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol |
| form | Crystalline Powder |
| pka | 1.77±0.28(Predicted) |
| color | Off-white or pale yellow |
| Usage | Used for preparation of pyridine derivatives as inhibitors of human 11 hydroxysteroid dehydrogenase type 1 enzyme. |
| BRN | 136114 |
| InChI | InChI=1S/C6H3Cl2NO2/c7-4-2-1-3(6(10)11)5(8)9-4/h1-2H,(H,10,11) |
| InChIKey | AJPKQSSFYHPYMH-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(Cl)=CC=C1C(O)=O |
| CAS DataBase Reference | 38496-18-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| REACH Registrations | Active |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |